About 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid
3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid (PubChem CID 23497708) has the molecular formula C24H24N6O2
and a molecular weight of 428.50 g/mol. Its IUPAC name is 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid |
| PubChem CID | 23497708 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid |
| SMILES | C/N=C(\NC#N)N1CCN(Cc2c(-c3ccccc3)nc3ccccc3c2C(=O)O)CC1 |
| InChI | InChI=1S/C24H24N6O2/c1-26-24(27-16-25)30-13-11-29(12-14-30)15-19-21(23(31)32)18-9-5-6-10-20(18)28-22(19)17-7-3-2-4-8-17/h2-10H,11-15H2,1H3,(H,26,27)(H,31,32) |
| InChIKey | PRLOHFZDQLJIJN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid?
The IUPAC name of 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid (CID 23497708) is 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid.
What is the SMILES notation for 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid?
The canonical SMILES for 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid is C/N=C(\NC#N)N1CCN(Cc2c(-c3ccccc3)nc3ccccc3c2C(=O)O)CC1.
What is the InChIKey of 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid?
The InChIKey is PRLOHFZDQLJIJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N6O2/c1-26-24(27-16-25)30-13-11-29(12-14-30)15-19-21(23(31)32)18-9-5-6-10-20(18)28-22(19)17-7-3-2-4-8-17/h2-10H,11-15H2,1H3,(H,26,27)(H,31,32).
What are the key properties of 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid?
3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid has a molecular weight of 428.50 g/mol, XLogP of 2.77, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(N-cyano-N'-methylcarbamimidoyl)piperazin-1-yl]methyl]-2-phenylquinoline-4-carboxylic acid is sourced from PubChem (CID 23497708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).