About bromomethylbenzene;quinoline
bromomethylbenzene;quinoline (PubChem CID 23497775) has the molecular formula C16H14BrN
and a molecular weight of 300.20 g/mol. Its IUPAC name is bromomethylbenzene;quinoline.
Molecular Properties
| Compound Name | bromomethylbenzene;quinoline |
| PubChem CID | 23497775 |
| Molecular Formula | C16H14BrN |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | bromomethylbenzene;quinoline |
| SMILES | BrCc1ccccc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C7H7Br/c1-2-6-9-8(4-1)5-3-7-10-9;8-6-7-4-2-1-3-5-7/h1-7H;1-5H,6H2 |
| InChIKey | ACXDEPRFOBOBDA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromomethylbenzene;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethylbenzene;quinoline?
The IUPAC name of bromomethylbenzene;quinoline (CID 23497775) is bromomethylbenzene;quinoline.
What is the SMILES notation for bromomethylbenzene;quinoline?
The canonical SMILES for bromomethylbenzene;quinoline is BrCc1ccccc1.c1ccc2ncccc2c1.
What is the InChIKey of bromomethylbenzene;quinoline?
The InChIKey is ACXDEPRFOBOBDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C7H7Br/c1-2-6-9-8(4-1)5-3-7-10-9;8-6-7-4-2-1-3-5-7/h1-7H;1-5H,6H2.
What are the key properties of bromomethylbenzene;quinoline?
bromomethylbenzene;quinoline has a molecular weight of 300.20 g/mol, XLogP of 4.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethylbenzene;quinoline is sourced from PubChem (CID 23497775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).