About 3H-dioxole-4-carboxylic acid
3H-dioxole-4-carboxylic acid (PubChem CID 23497792) has the molecular formula C4H4O4
and a molecular weight of 116.07 g/mol. Its IUPAC name is 3H-dioxole-4-carboxylic acid.
Molecular Properties
| Compound Name | 3H-dioxole-4-carboxylic acid |
| PubChem CID | 23497792 |
| Molecular Formula | C4H4O4 |
| Molecular Weight | 116.07 g/mol |
| Exact Mass | 116.01 |
| IUPAC Name | 3H-dioxole-4-carboxylic acid |
| SMILES | O=C(O)C1=COOC1 |
| InChI | InChI=1S/C4H4O4/c5-4(6)3-1-7-8-2-3/h1H,2H2,(H,5,6) |
| InChIKey | PJQLWEPOJZRVGS-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.07 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3H-dioxole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-dioxole-4-carboxylic acid?
The IUPAC name of 3H-dioxole-4-carboxylic acid (CID 23497792) is 3H-dioxole-4-carboxylic acid.
What is the SMILES notation for 3H-dioxole-4-carboxylic acid?
The canonical SMILES for 3H-dioxole-4-carboxylic acid is O=C(O)C1=COOC1.
What is the InChIKey of 3H-dioxole-4-carboxylic acid?
The InChIKey is PJQLWEPOJZRVGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O4/c5-4(6)3-1-7-8-2-3/h1H,2H2,(H,5,6).
What are the key properties of 3H-dioxole-4-carboxylic acid?
3H-dioxole-4-carboxylic acid has a molecular weight of 116.07 g/mol, XLogP of -0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-dioxole-4-carboxylic acid is sourced from PubChem (CID 23497792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).