C10H14Cl6 — CID 23497888
1,2,3,4,5,6-hexachlorocyclodecane (PubChem CID 23497888) has the molecular formula C10H14Cl6 and a molecular weight of 346.94 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexachlorocyclodecane.
| Compound Name | 1,2,3,4,5,6-hexachlorocyclodecane |
|---|---|
| PubChem CID | 23497888 |
| Molecular Formula | C10H14Cl6 |
| Molecular Weight | 346.94 g/mol |
| Exact Mass | 343.92 |
| IUPAC Name | 1,2,3,4,5,6-hexachlorocyclodecane |
| SMILES | ClC1CCCCC(Cl)C(Cl)C(Cl)C(Cl)C1Cl |
| InChI | InChI=1S/C10H14Cl6/c11-5-3-1-2-4-6(12)8(14)10(16)9(15)7(5)13/h5-10H,1-4H2 |
| InChIKey | VZAFQNSGDJLCDO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|