About 2-Methylpropenyl-silane
2-Methylpropenyl-silane (PubChem CID 23497903) has the molecular formula C4H7Si
and a molecular weight of 83.19 g/mol.
Molecular Properties
| Compound Name | 2-Methylpropenyl-silane |
| PubChem CID | 23497903 |
| Molecular Formula | C4H7Si |
| Molecular Weight | 83.19 g/mol |
| Exact Mass | 83.03 |
| IUPAC Name | — |
| SMILES | CC(C)=C[Si] |
| InChI | InChI=1S/C4H7Si/c1-4(2)3-5/h3H,1-2H3 |
| InChIKey | BFFJYCBARCFZNP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-Methylpropenyl-silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Methylpropenyl-silane?
The IUPAC name of 2-Methylpropenyl-silane (CID 23497903) is not available.
What is the SMILES notation for 2-Methylpropenyl-silane?
The canonical SMILES for 2-Methylpropenyl-silane is CC(C)=C[Si].
What is the InChIKey of 2-Methylpropenyl-silane?
The InChIKey is BFFJYCBARCFZNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7Si/c1-4(2)3-5/h3H,1-2H3.
What are the key properties of 2-Methylpropenyl-silane?
2-Methylpropenyl-silane has a molecular weight of 83.19 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Methylpropenyl-silane is sourced from PubChem (CID 23497903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).