About 2-hydroxypropyl 2-ethylhexanoate
2-hydroxypropyl 2-ethylhexanoate (PubChem CID 23497921) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 2-hydroxypropyl 2-ethylhexanoate.
Molecular Properties
| Compound Name | 2-hydroxypropyl 2-ethylhexanoate |
| PubChem CID | 23497921 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2-hydroxypropyl 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)OCC(C)O |
| InChI | InChI=1S/C11H22O3/c1-4-6-7-10(5-2)11(13)14-8-9(3)12/h9-10,12H,4-8H2,1-3H3 |
| InChIKey | RCYYLBZELJCFBT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxypropyl 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl 2-ethylhexanoate?
The IUPAC name of 2-hydroxypropyl 2-ethylhexanoate (CID 23497921) is 2-hydroxypropyl 2-ethylhexanoate.
What is the SMILES notation for 2-hydroxypropyl 2-ethylhexanoate?
The canonical SMILES for 2-hydroxypropyl 2-ethylhexanoate is CCCCC(CC)C(=O)OCC(C)O.
What is the InChIKey of 2-hydroxypropyl 2-ethylhexanoate?
The InChIKey is RCYYLBZELJCFBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-4-6-7-10(5-2)11(13)14-8-9(3)12/h9-10,12H,4-8H2,1-3H3.
What are the key properties of 2-hydroxypropyl 2-ethylhexanoate?
2-hydroxypropyl 2-ethylhexanoate has a molecular weight of 202.29 g/mol, XLogP of 2.13, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl 2-ethylhexanoate is sourced from PubChem (CID 23497921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).