C25H19BF15N — CID 23497991
methyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide;triethylazanium (PubChem CID 23497991) has the molecular formula C25H19BF15N and a molecular weight of 629.22 g/mol. Its IUPAC name is methyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide;triethylazanium.
| Compound Name | methyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide;triethylazanium |
|---|---|
| PubChem CID | 23497991 |
| Molecular Formula | C25H19BF15N |
| Molecular Weight | 629.22 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | methyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide;triethylazanium |
| SMILES | CC[NH+](CC)CC.C[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H3BF15.C6H15N/c1-20(2-5(21)11(27)17(33)12(28)6(2)22,3-7(23)13(29)18(34)14(30)8(3)24)4-9(25)15(31)19(35)16(32)10(4)26;1-4-7(5-2)6-3/h1H3;4-6H2,1-3H3/q-1;/p+1 |
| InChIKey | JRQKRNCCJJEKTQ-UHFFFAOYSA-O |
| XLogP | 4.80 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.22 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|