About 2-fluoro-5-nitrophenol
2-fluoro-5-nitrophenol (PubChem CID 23498100) has the molecular formula C6H4FNO3
and a molecular weight of 157.10 g/mol. Its IUPAC name is 2-fluoro-5-nitrophenol.
Molecular Properties
| Compound Name | 2-fluoro-5-nitrophenol |
| PubChem CID | 23498100 |
| Molecular Formula | C6H4FNO3 |
| Molecular Weight | 157.10 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 2-fluoro-5-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(F)c(O)c1 |
| InChI | InChI=1S/C6H4FNO3/c7-5-2-1-4(8(10)11)3-6(5)9/h1-3,9H |
| InChIKey | WFRLFZAMCVAQLN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.10 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-5-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-nitrophenol?
The IUPAC name of 2-fluoro-5-nitrophenol (CID 23498100) is 2-fluoro-5-nitrophenol.
What is the SMILES notation for 2-fluoro-5-nitrophenol?
The canonical SMILES for 2-fluoro-5-nitrophenol is O=[N+]([O-])c1ccc(F)c(O)c1.
What is the InChIKey of 2-fluoro-5-nitrophenol?
The InChIKey is WFRLFZAMCVAQLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4FNO3/c7-5-2-1-4(8(10)11)3-6(5)9/h1-3,9H.
What are the key properties of 2-fluoro-5-nitrophenol?
2-fluoro-5-nitrophenol has a molecular weight of 157.10 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-nitrophenol is sourced from PubChem (CID 23498100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).