About 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine
4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine (PubChem CID 23498121) has the molecular formula C15H32N2O
and a molecular weight of 256.43 g/mol. Its IUPAC name is 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine.
Molecular Properties
| Compound Name | 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine |
| PubChem CID | 23498121 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine |
| SMILES | COCCC(C)(CC1CCN(C)CC1)CN(C)C |
| InChI | InChI=1S/C15H32N2O/c1-15(8-11-18-5,13-16(2)3)12-14-6-9-17(4)10-7-14/h14H,6-13H2,1-5H3 |
| InChIKey | VDPFXYLRXLHABC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine?
The IUPAC name of 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine (CID 23498121) is 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine.
What is the SMILES notation for 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine?
The canonical SMILES for 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine is COCCC(C)(CC1CCN(C)CC1)CN(C)C.
What is the InChIKey of 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine?
The InChIKey is VDPFXYLRXLHABC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O/c1-15(8-11-18-5,13-16(2)3)12-14-6-9-17(4)10-7-14/h14H,6-13H2,1-5H3.
What are the key properties of 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine?
4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine has a molecular weight of 256.43 g/mol, XLogP of 2.32, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N,N,2-trimethyl-2-[(1-methylpiperidin-4-yl)methyl]butan-1-amine is sourced from PubChem (CID 23498121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).