C26H54O5 — CID 23498291
butyl octadecanoate;2-(2-hydroxyethoxy)ethanol (PubChem CID 23498291) has the molecular formula C26H54O5 and a molecular weight of 446.71 g/mol. Its IUPAC name is butyl octadecanoate;2-(2-hydroxyethoxy)ethanol.
| Compound Name | butyl octadecanoate;2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 23498291 |
| Molecular Formula | C26H54O5 |
| Molecular Weight | 446.71 g/mol |
| Exact Mass | 446.40 |
| IUPAC Name | butyl octadecanoate;2-(2-hydroxyethoxy)ethanol |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCCCC.OCCOCCO |
| InChI | InChI=1S/C22H44O2.C4H10O3/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(23)24-21-6-4-2;5-1-3-7-4-2-6/h3-21H2,1-2H3;5-6H,1-4H2 |
| InChIKey | WKRRKPRGXGTXBK-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|