C28H33BrO4 — CID 23498913
ethyl 4-[(E)-2-[6-acetyloxy-3-(bromomethyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]ethenyl]benzoate (PubChem CID 23498913) has the molecular formula C28H33BrO4 and a molecular weight of 513.47 g/mol. Its IUPAC name is ethyl 4-[(E)-2-[6-acetyloxy-3-(bromomethyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]ethenyl]benzoate.
| Compound Name | ethyl 4-[(E)-2-[6-acetyloxy-3-(bromomethyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 23498913 |
| Molecular Formula | C28H33BrO4 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | ethyl 4-[(E)-2-[6-acetyloxy-3-(bromomethyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]ethenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/C=C/c2cc3c(cc2CBr)C(C)(C)C(OC(C)=O)CC3(C)C)cc1 |
| InChI | InChI=1S/C28H33BrO4/c1-7-32-26(31)20-11-8-19(9-12-20)10-13-21-14-23-24(15-22(21)17-29)28(5,6)25(33-18(2)30)16-27(23,3)4/h8-15,25H,7,16-17H2,1-6H3/b13-10+ |
| InChIKey | YVYIFTAGHWXJQE-JLHYYAGUSA-N |
| XLogP | 6.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|