About [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate
[2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate (PubChem CID 2349901) has the molecular formula C17H15F2NO5
and a molecular weight of 351.31 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate.
Molecular Properties
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate |
| PubChem CID | 2349901 |
| Molecular Formula | C17H15F2NO5 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc(F)cc2F)cc1OC |
| InChI | InChI=1S/C17H15F2NO5/c1-23-14-6-3-10(7-15(14)24-2)17(22)25-9-16(21)20-13-5-4-11(18)8-12(13)19/h3-8H,9H2,1-2H3,(H,20,21) |
| InChIKey | MIWSQUSYKLXCSI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate?
The IUPAC name of [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate (CID 2349901) is [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate.
What is the SMILES notation for [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate?
The canonical SMILES for [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate is COc1ccc(C(=O)OCC(=O)Nc2ccc(F)cc2F)cc1OC.
What is the InChIKey of [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate?
The InChIKey is MIWSQUSYKLXCSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2NO5/c1-23-14-6-3-10(7-15(14)24-2)17(22)25-9-16(21)20-13-5-4-11(18)8-12(13)19/h3-8H,9H2,1-2H3,(H,20,21).
What are the key properties of [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate?
[2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate has a molecular weight of 351.31 g/mol, XLogP of 2.78, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate is sourced from PubChem (CID 2349901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).