About 3-ethyl-4-methylaniline;hydrochloride
3-ethyl-4-methylaniline;hydrochloride (PubChem CID 23499109) has the molecular formula C9H14ClN
and a molecular weight of 171.67 g/mol. Its IUPAC name is 3-ethyl-4-methylaniline;hydrochloride.
Molecular Properties
| Compound Name | 3-ethyl-4-methylaniline;hydrochloride |
| PubChem CID | 23499109 |
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.67 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 3-ethyl-4-methylaniline;hydrochloride |
| SMILES | CCc1cc(N)ccc1C.Cl |
| InChI | InChI=1S/C9H13N.ClH/c1-3-8-6-9(10)5-4-7(8)2;/h4-6H,3,10H2,1-2H3;1H |
| InChIKey | IPVWTJALINKFOZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-4-methylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-methylaniline;hydrochloride?
The IUPAC name of 3-ethyl-4-methylaniline;hydrochloride (CID 23499109) is 3-ethyl-4-methylaniline;hydrochloride.
What is the SMILES notation for 3-ethyl-4-methylaniline;hydrochloride?
The canonical SMILES for 3-ethyl-4-methylaniline;hydrochloride is CCc1cc(N)ccc1C.Cl.
What is the InChIKey of 3-ethyl-4-methylaniline;hydrochloride?
The InChIKey is IPVWTJALINKFOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.ClH/c1-3-8-6-9(10)5-4-7(8)2;/h4-6H,3,10H2,1-2H3;1H.
What are the key properties of 3-ethyl-4-methylaniline;hydrochloride?
3-ethyl-4-methylaniline;hydrochloride has a molecular weight of 171.67 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-methylaniline;hydrochloride is sourced from PubChem (CID 23499109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).