C21H22F3N3OS — CID 23499312
1-[3-(1-ethylpiperidine-4-carbonyl)phenyl]-1-(2,4,5-trifluorophenyl)thiourea (PubChem CID 23499312) has the molecular formula C21H22F3N3OS and a molecular weight of 421.49 g/mol. Its IUPAC name is 1-[3-(1-ethylpiperidine-4-carbonyl)phenyl]-1-(2,4,5-trifluorophenyl)thiourea.
| Compound Name | 1-[3-(1-ethylpiperidine-4-carbonyl)phenyl]-1-(2,4,5-trifluorophenyl)thiourea |
|---|---|
| PubChem CID | 23499312 |
| Molecular Formula | C21H22F3N3OS |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 1-[3-(1-ethylpiperidine-4-carbonyl)phenyl]-1-(2,4,5-trifluorophenyl)thiourea |
| SMILES | CCN1CCC(C(=O)c2cccc(N(C(N)=S)c3cc(F)c(F)cc3F)c2)CC1 |
| InChI | InChI=1S/C21H22F3N3OS/c1-2-26-8-6-13(7-9-26)20(28)14-4-3-5-15(10-14)27(21(25)29)19-12-17(23)16(22)11-18(19)24/h3-5,10-13H,2,6-9H2,1H3,(H2,25,29) |
| InChIKey | HZPHLRHOTZEYMH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|