About 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide
2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide (PubChem CID 23499828) has the molecular formula C15H30N2O3
and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide |
| PubChem CID | 23499828 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide |
| SMILES | CCCCN(C)C(=O)CC1CC(CCN)OC(C)(C)O1 |
| InChI | InChI=1S/C15H30N2O3/c1-5-6-9-17(4)14(18)11-13-10-12(7-8-16)19-15(2,3)20-13/h12-13H,5-11,16H2,1-4H3 |
| InChIKey | KMPNYNXYWUGCQP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide?
The IUPAC name of 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide (CID 23499828) is 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide.
What is the SMILES notation for 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide?
The canonical SMILES for 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide is CCCCN(C)C(=O)CC1CC(CCN)OC(C)(C)O1.
What is the InChIKey of 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide?
The InChIKey is KMPNYNXYWUGCQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O3/c1-5-6-9-17(4)14(18)11-13-10-12(7-8-16)19-15(2,3)20-13/h12-13H,5-11,16H2,1-4H3.
What are the key properties of 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide?
2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide has a molecular weight of 286.42 g/mol, XLogP of 1.89, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-butyl-N-methylacetamide is sourced from PubChem (CID 23499828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).