C20H32O2 — CID 23499832
(8-ethyl-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl) 2,2-dimethylbutanoate (PubChem CID 23499832) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (8-ethyl-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl) 2,2-dimethylbutanoate.
| Compound Name | (8-ethyl-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 23499832 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (8-ethyl-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl) 2,2-dimethylbutanoate |
| SMILES | CCC1C(C)C=CC2=CC(C)CC(OC(=O)C(C)(C)CC)C21 |
| InChI | InChI=1S/C20H32O2/c1-7-16-14(4)9-10-15-11-13(3)12-17(18(15)16)22-19(21)20(5,6)8-2/h9-11,13-14,16-18H,7-8,12H2,1-6H3 |
| InChIKey | WQQAOQFNQREXCR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |