About 1-propylcyclohexa-2,4-diene-1-carbonitrile
1-propylcyclohexa-2,4-diene-1-carbonitrile (PubChem CID 23499843) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 1-propylcyclohexa-2,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 1-propylcyclohexa-2,4-diene-1-carbonitrile |
| PubChem CID | 23499843 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 1-propylcyclohexa-2,4-diene-1-carbonitrile |
| SMILES | CCCC1(C#N)C=CC=CC1 |
| InChI | InChI=1S/C10H13N/c1-2-6-10(9-11)7-4-3-5-8-10/h3-5,7H,2,6,8H2,1H3 |
| InChIKey | AQTOVHGZBDGRHT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-propylcyclohexa-2,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propylcyclohexa-2,4-diene-1-carbonitrile?
The IUPAC name of 1-propylcyclohexa-2,4-diene-1-carbonitrile (CID 23499843) is 1-propylcyclohexa-2,4-diene-1-carbonitrile.
What is the SMILES notation for 1-propylcyclohexa-2,4-diene-1-carbonitrile?
The canonical SMILES for 1-propylcyclohexa-2,4-diene-1-carbonitrile is CCCC1(C#N)C=CC=CC1.
What is the InChIKey of 1-propylcyclohexa-2,4-diene-1-carbonitrile?
The InChIKey is AQTOVHGZBDGRHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-2-6-10(9-11)7-4-3-5-8-10/h3-5,7H,2,6,8H2,1H3.
What are the key properties of 1-propylcyclohexa-2,4-diene-1-carbonitrile?
1-propylcyclohexa-2,4-diene-1-carbonitrile has a molecular weight of 147.22 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylcyclohexa-2,4-diene-1-carbonitrile is sourced from PubChem (CID 23499843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).