C24H21IN2O5S — CID 2350003
[2-(4-iodoanilino)-2-oxoethyl] 3-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoate (PubChem CID 2350003) has the molecular formula C24H21IN2O5S and a molecular weight of 576.41 g/mol. Its IUPAC name is [2-(4-iodoanilino)-2-oxoethyl] 3-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoate.
| Compound Name | [2-(4-iodoanilino)-2-oxoethyl] 3-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoate |
|---|---|
| PubChem CID | 2350003 |
| Molecular Formula | C24H21IN2O5S |
| Molecular Weight | 576.41 g/mol |
| Exact Mass | 576.02 |
| IUPAC Name | [2-(4-iodoanilino)-2-oxoethyl] 3-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoate |
| SMILES | C[C@@H]1Cc2ccccc2N1S(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C24H21IN2O5S/c1-16-13-17-5-2-3-8-22(17)27(16)33(30,31)21-7-4-6-18(14-21)24(29)32-15-23(28)26-20-11-9-19(25)10-12-20/h2-12,14,16H,13,15H2,1H3,(H,26,28)/t16-/m1/s1 |
| InChIKey | RTRNMGXDOIIQNK-MRXNPFEDSA-N |
| XLogP | 4.23 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|