About 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid)
1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid) (PubChem CID 23500155) has the molecular formula C32H58O4
and a molecular weight of 506.81 g/mol. Its IUPAC name is 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid).
Molecular Properties
| Compound Name | 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid) |
| PubChem CID | 23500155 |
| Molecular Formula | C32H58O4 |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 506.43 |
| IUPAC Name | 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.CC1CCCCCCCCCC1(C)C1CCCCCCCCCC1 |
| InChI | InChI=1S/C24H46.2C4H6O2/c1-22-18-14-10-6-5-9-13-17-21-24(22,2)23-19-15-11-7-3-4-8-12-16-20-23;2*1-3(2)4(5)6/h22-23H,3-21H2,1-2H3;2*1H2,2H3,(H,5,6) |
| InChIKey | HVKFUDKHQRBNBM-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid)?
The IUPAC name of 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid) (CID 23500155) is 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid).
What is the SMILES notation for 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid)?
The canonical SMILES for 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid) is C=C(C)C(=O)O.C=C(C)C(=O)O.CC1CCCCCCCCCC1(C)C1CCCCCCCCCC1.
What is the InChIKey of 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid)?
The InChIKey is HVKFUDKHQRBNBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46.2C4H6O2/c1-22-18-14-10-6-5-9-13-17-21-24(22,2)23-19-15-11-7-3-4-8-12-16-20-23;2*1-3(2)4(5)6/h22-23H,3-21H2,1-2H3;2*1H2,2H3,(H,5,6).
What are the key properties of 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid)?
1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid) has a molecular weight of 506.81 g/mol, XLogP of 9.98, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloundecyl-1,2-dimethylcycloundecane;bis(2-methylprop-2-enoic acid) is sourced from PubChem (CID 23500155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).