C17H21N3O7 — CID 23500475
2-(2,5-dioxopyrrolidin-1-yl)-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid (PubChem CID 23500475) has the molecular formula C17H21N3O7 and a molecular weight of 379.37 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 23500475 |
| Molecular Formula | C17H21N3O7 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCCCC(C(=O)O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C17H21N3O7/c21-12(8-10-19-13(22)4-5-14(19)23)18-9-2-1-3-11(17(26)27)20-15(24)6-7-16(20)25/h4-5,11H,1-3,6-10H2,(H,18,21)(H,26,27) |
| InChIKey | WTTBAQAXSWGSLB-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|