About [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate
[2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 2350080) has the molecular formula C13H12Cl3NO4
and a molecular weight of 352.60 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate.
Molecular Properties
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
| PubChem CID | 2350080 |
| Molecular Formula | C13H12Cl3NO4 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1cc(Cl)c(Cl)cc1Cl)NC1CC1 |
| InChI | InChI=1S/C13H12Cl3NO4/c14-8-3-10(16)11(4-9(8)15)20-6-13(19)21-5-12(18)17-7-1-2-7/h3-4,7H,1-2,5-6H2,(H,17,18) |
| InChIKey | BUGYEUGXZDTGFU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate?
The IUPAC name of [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate (CID 2350080) is [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate.
What is the SMILES notation for [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate?
The canonical SMILES for [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate is O=C(COC(=O)COc1cc(Cl)c(Cl)cc1Cl)NC1CC1.
What is the InChIKey of [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate?
The InChIKey is BUGYEUGXZDTGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl3NO4/c14-8-3-10(16)11(4-9(8)15)20-6-13(19)21-5-12(18)17-7-1-2-7/h3-4,7H,1-2,5-6H2,(H,17,18).
What are the key properties of [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate?
[2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate has a molecular weight of 352.60 g/mol, XLogP of 2.85, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclopropylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate is sourced from PubChem (CID 2350080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).