C19H18F4N2O5S — CID 23501233
2-[1-(3-fluorophenyl)sulfonylindol-4-yl]oxy-N-methylethanamine;2,2,2-trifluoroacetic acid (PubChem CID 23501233) has the molecular formula C19H18F4N2O5S and a molecular weight of 462.42 g/mol. Its IUPAC name is 2-[1-(3-fluorophenyl)sulfonylindol-4-yl]oxy-N-methylethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[1-(3-fluorophenyl)sulfonylindol-4-yl]oxy-N-methylethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23501233 |
| Molecular Formula | C19H18F4N2O5S |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2-[1-(3-fluorophenyl)sulfonylindol-4-yl]oxy-N-methylethanamine;2,2,2-trifluoroacetic acid |
| SMILES | CNCCOc1cccc2c1ccn2S(=O)(=O)c1cccc(F)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H17FN2O3S.C2HF3O2/c1-19-9-11-23-17-7-3-6-16-15(17)8-10-20(16)24(21,22)14-5-2-4-13(18)12-14;3-2(4,5)1(6)7/h2-8,10,12,19H,9,11H2,1H3;(H,6,7) |
| InChIKey | DXOZWBWSEPZCIX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|