C20H20F4N2O5S — CID 23501303
2-[1-(5-fluoro-2-methylphenyl)sulfonylindol-4-yl]oxy-N-methylethanamine;2,2,2-trifluoroacetic acid (PubChem CID 23501303) has the molecular formula C20H20F4N2O5S and a molecular weight of 476.45 g/mol. Its IUPAC name is 2-[1-(5-fluoro-2-methylphenyl)sulfonylindol-4-yl]oxy-N-methylethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[1-(5-fluoro-2-methylphenyl)sulfonylindol-4-yl]oxy-N-methylethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23501303 |
| Molecular Formula | C20H20F4N2O5S |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 2-[1-(5-fluoro-2-methylphenyl)sulfonylindol-4-yl]oxy-N-methylethanamine;2,2,2-trifluoroacetic acid |
| SMILES | CNCCOc1cccc2c1ccn2S(=O)(=O)c1cc(F)ccc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H19FN2O3S.C2HF3O2/c1-13-6-7-14(19)12-18(13)25(22,23)21-10-8-15-16(21)4-3-5-17(15)24-11-9-20-2;3-2(4,5)1(6)7/h3-8,10,12,20H,9,11H2,1-2H3;(H,6,7) |
| InChIKey | LNMXTIHBJHTRNQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|