C20H21F3N2O7S2 — CID 23501305
N-methyl-2-[1-(2-methylsulfonylphenyl)sulfonylindol-4-yl]oxyethanamine;2,2,2-trifluoroacetic acid (PubChem CID 23501305) has the molecular formula C20H21F3N2O7S2 and a molecular weight of 522.52 g/mol. Its IUPAC name is N-methyl-2-[1-(2-methylsulfonylphenyl)sulfonylindol-4-yl]oxyethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-methyl-2-[1-(2-methylsulfonylphenyl)sulfonylindol-4-yl]oxyethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23501305 |
| Molecular Formula | C20H21F3N2O7S2 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | N-methyl-2-[1-(2-methylsulfonylphenyl)sulfonylindol-4-yl]oxyethanamine;2,2,2-trifluoroacetic acid |
| SMILES | CNCCOc1cccc2c1ccn2S(=O)(=O)c1ccccc1S(C)(=O)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H20N2O5S2.C2HF3O2/c1-19-11-13-25-16-7-5-6-15-14(16)10-12-20(15)27(23,24)18-9-4-3-8-17(18)26(2,21)22;3-2(4,5)1(6)7/h3-10,12,19H,11,13H2,1-2H3;(H,6,7) |
| InChIKey | KHGCZRBIRIMYBS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 131.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|