C36H39NO6 — CID 23501721
4-[2-(2-carboxyethyl)-3-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexyl]phenoxy]butanoic acid (PubChem CID 23501721) has the molecular formula C36H39NO6 and a molecular weight of 581.71 g/mol. Its IUPAC name is 4-[2-(2-carboxyethyl)-3-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-(2-carboxyethyl)-3-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 23501721 |
| Molecular Formula | C36H39NO6 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 4-[2-(2-carboxyethyl)-3-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccccc3)cc(-c3ccccc3)n2)c1CCC(=O)O |
| InChI | InChI=1S/C36H39NO6/c38-35(39)20-12-24-42-33-19-11-18-28(31(33)21-22-36(40)41)15-5-1-2-10-23-43-34-26-30(27-13-6-3-7-14-27)25-32(37-34)29-16-8-4-9-17-29/h3-4,6-9,11,13-14,16-19,25-26H,1-2,5,10,12,15,20-24H2,(H,38,39)(H,40,41) |
| InChIKey | IQMZIBZJCFEUSM-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|