C32H32N2O4 — CID 23501836
7-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (PubChem CID 23501836) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is 7-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid.
| Compound Name | 7-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23501836 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 7-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccc(OCCCCCOc3cc(-c4ccccc4)cc(-c4ccccc4)n3)cc2CN1 |
| InChI | InChI=1S/C32H32N2O4/c35-32(36)30-19-25-14-15-28(18-27(25)22-33-30)37-16-8-3-9-17-38-31-21-26(23-10-4-1-5-11-23)20-29(34-31)24-12-6-2-7-13-24/h1-2,4-7,10-15,18,20-21,30,33H,3,8-9,16-17,19,22H2,(H,35,36) |
| InChIKey | RZYGQUCBAMJZCJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|