About 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile
6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile (PubChem CID 23501840) has the molecular formula C25H25FN2O
and a molecular weight of 388.49 g/mol. Its IUPAC name is 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile.
Molecular Properties
| Compound Name | 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile |
| PubChem CID | 23501840 |
| Molecular Formula | C25H25FN2O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCOc1cc(-c2ccccc2)cc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C25H25FN2O/c1-25(2,18-27)14-6-7-15-29-24-17-21(19-8-4-3-5-9-19)16-23(28-24)20-10-12-22(26)13-11-20/h3-5,8-13,16-17H,6-7,14-15H2,1-2H3 |
| InChIKey | CNBNVBKNAWJZHZ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile?
The IUPAC name of 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile (CID 23501840) is 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile.
What is the SMILES notation for 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile?
The canonical SMILES for 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile is CC(C)(C#N)CCCCOc1cc(-c2ccccc2)cc(-c2ccc(F)cc2)n1.
What is the InChIKey of 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile?
The InChIKey is CNBNVBKNAWJZHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25FN2O/c1-25(2,18-27)14-6-7-15-29-24-17-21(19-8-4-3-5-9-19)16-23(28-24)20-10-12-22(26)13-11-20/h3-5,8-13,16-17H,6-7,14-15H2,1-2H3.
What are the key properties of 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile?
6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile has a molecular weight of 388.49 g/mol, XLogP of 6.65, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexanenitrile is sourced from PubChem (CID 23501840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).