About ethanamine;pyrrole-2,5-dione
ethanamine;pyrrole-2,5-dione (PubChem CID 23502083) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is ethanamine;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | ethanamine;pyrrole-2,5-dione |
| PubChem CID | 23502083 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | ethanamine;pyrrole-2,5-dione |
| SMILES | CCN.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H3NO2.C2H7N/c6-3-1-2-4(7)5-3;1-2-3/h1-2H,(H,5,6,7);2-3H2,1H3 |
| InChIKey | UEQBQENWTSTNBD-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;pyrrole-2,5-dione?
The IUPAC name of ethanamine;pyrrole-2,5-dione (CID 23502083) is ethanamine;pyrrole-2,5-dione.
What is the SMILES notation for ethanamine;pyrrole-2,5-dione?
The canonical SMILES for ethanamine;pyrrole-2,5-dione is CCN.O=C1C=CC(=O)N1.
What is the InChIKey of ethanamine;pyrrole-2,5-dione?
The InChIKey is UEQBQENWTSTNBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.C2H7N/c6-3-1-2-4(7)5-3;1-2-3/h1-2H,(H,5,6,7);2-3H2,1H3.
What are the key properties of ethanamine;pyrrole-2,5-dione?
ethanamine;pyrrole-2,5-dione has a molecular weight of 142.16 g/mol, XLogP of -0.84, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;pyrrole-2,5-dione is sourced from PubChem (CID 23502083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).