About cyclohex-3-ene-1,2-dicarboxamide
cyclohex-3-ene-1,2-dicarboxamide (PubChem CID 23502542) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is cyclohex-3-ene-1,2-dicarboxamide.
Molecular Properties
| Compound Name | cyclohex-3-ene-1,2-dicarboxamide |
| PubChem CID | 23502542 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | cyclohex-3-ene-1,2-dicarboxamide |
| SMILES | NC(=O)C1C=CCCC1C(N)=O |
| InChI | InChI=1S/C8H12N2O2/c9-7(11)5-3-1-2-4-6(5)8(10)12/h1,3,5-6H,2,4H2,(H2,9,11)(H2,10,12) |
| InChIKey | OBDHDEWJGUTWOK-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohex-3-ene-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-3-ene-1,2-dicarboxamide?
The IUPAC name of cyclohex-3-ene-1,2-dicarboxamide (CID 23502542) is cyclohex-3-ene-1,2-dicarboxamide.
What is the SMILES notation for cyclohex-3-ene-1,2-dicarboxamide?
The canonical SMILES for cyclohex-3-ene-1,2-dicarboxamide is NC(=O)C1C=CCCC1C(N)=O.
What is the InChIKey of cyclohex-3-ene-1,2-dicarboxamide?
The InChIKey is OBDHDEWJGUTWOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c9-7(11)5-3-1-2-4-6(5)8(10)12/h1,3,5-6H,2,4H2,(H2,9,11)(H2,10,12).
What are the key properties of cyclohex-3-ene-1,2-dicarboxamide?
cyclohex-3-ene-1,2-dicarboxamide has a molecular weight of 168.20 g/mol, XLogP of -0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-3-ene-1,2-dicarboxamide is sourced from PubChem (CID 23502542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).