About (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate
(3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate (PubChem CID 23502574) has the molecular formula C17H17ClN4O3S
and a molecular weight of 392.87 g/mol. Its IUPAC name is (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate.
Molecular Properties
| Compound Name | (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate |
| PubChem CID | 23502574 |
| Molecular Formula | C17H17ClN4O3S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate |
| SMILES | CCn1nnnc1SCc1cc(Cl)ccc1C(=O)OC1=CC(=O)CCC1 |
| InChI | InChI=1S/C17H17ClN4O3S/c1-2-22-17(19-20-21-22)26-10-11-8-12(18)6-7-15(11)16(24)25-14-5-3-4-13(23)9-14/h6-9H,2-5,10H2,1H3 |
| InChIKey | WQAJTKIEXNTIJM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate?
The IUPAC name of (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate (CID 23502574) is (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate.
What is the SMILES notation for (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate?
The canonical SMILES for (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate is CCn1nnnc1SCc1cc(Cl)ccc1C(=O)OC1=CC(=O)CCC1.
What is the InChIKey of (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate?
The InChIKey is WQAJTKIEXNTIJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN4O3S/c1-2-22-17(19-20-21-22)26-10-11-8-12(18)6-7-15(11)16(24)25-14-5-3-4-13(23)9-14/h6-9H,2-5,10H2,1H3.
What are the key properties of (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate?
(3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate has a molecular weight of 392.87 g/mol, XLogP of 3.43, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxocyclohexen-1-yl) 4-chloro-2-[(1-ethyltetrazol-5-yl)sulfanylmethyl]benzoate is sourced from PubChem (CID 23502574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).