C34H64O8SSi3 — CID 23502661
[3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enoxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 23502661) has the molecular formula C34H64O8SSi3 and a molecular weight of 717.20 g/mol. Its IUPAC name is [3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enoxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enoxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23502661 |
| Molecular Formula | C34H64O8SSi3 |
| Molecular Weight | 717.20 g/mol |
| Exact Mass | 716.36 |
| IUPAC Name | [3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enoxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | C=CCOC1OC(COS(=O)(=O)c2ccc(C)cc2)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H64O8SSi3/c1-18-23-37-31-30(42-46(16,17)34(9,10)11)29(41-45(14,15)33(6,7)8)28(40-44(12,13)32(3,4)5)27(39-31)24-38-43(35,36)26-21-19-25(2)20-22-26/h18-22,27-31H,1,23-24H2,2-17H3 |
| InChIKey | FYFMWZVCWPQWTA-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.20 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|