C27H40F2NO+ — CID 23502687
[2-[3-(2,6-difluorophenyl)propoxy]-2-(2,6-dimethylphenyl)ethyl]-(2-ethylbutyl)-dimethylazanium (PubChem CID 23502687) has the molecular formula C27H40F2NO+ and a molecular weight of 432.62 g/mol. Its IUPAC name is [2-[3-(2,6-difluorophenyl)propoxy]-2-(2,6-dimethylphenyl)ethyl]-(2-ethylbutyl)-dimethylazanium.
| Compound Name | [2-[3-(2,6-difluorophenyl)propoxy]-2-(2,6-dimethylphenyl)ethyl]-(2-ethylbutyl)-dimethylazanium |
|---|---|
| PubChem CID | 23502687 |
| Molecular Formula | C27H40F2NO+ |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | [2-[3-(2,6-difluorophenyl)propoxy]-2-(2,6-dimethylphenyl)ethyl]-(2-ethylbutyl)-dimethylazanium |
| SMILES | CCC(CC)C[N+](C)(C)CC(OCCCc1c(F)cccc1F)c1c(C)cccc1C |
| InChI | InChI=1S/C27H40F2NO/c1-7-22(8-2)18-30(5,6)19-26(27-20(3)12-9-13-21(27)4)31-17-11-14-23-24(28)15-10-16-25(23)29/h9-10,12-13,15-16,22,26H,7-8,11,14,17-19H2,1-6H3/q+1 |
| InChIKey | ILAVJULKQJGCSL-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|