C24H31F5NO+ — CID 23502698
[2-[3-(2,6-difluorophenyl)propoxy]-2-(2,6-dimethylphenyl)ethyl]-dimethyl-(3,3,3-trifluoropropyl)azanium (PubChem CID 23502698) has the molecular formula C24H31F5NO+ and a molecular weight of 444.51 g/mol. Its IUPAC name is [2-[3-(2,6-difluorophenyl)propoxy]-2-(2,6-dimethylphenyl)ethyl]-dimethyl-(3,3,3-trifluoropropyl)azanium.
| Compound Name | [2-[3-(2,6-difluorophenyl)propoxy]-2-(2,6-dimethylphenyl)ethyl]-dimethyl-(3,3,3-trifluoropropyl)azanium |
|---|---|
| PubChem CID | 23502698 |
| Molecular Formula | C24H31F5NO+ |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [2-[3-(2,6-difluorophenyl)propoxy]-2-(2,6-dimethylphenyl)ethyl]-dimethyl-(3,3,3-trifluoropropyl)azanium |
| SMILES | Cc1cccc(C)c1C(C[N+](C)(C)CCC(F)(F)F)OCCCc1c(F)cccc1F |
| InChI | InChI=1S/C24H31F5NO/c1-17-8-5-9-18(2)23(17)22(16-30(3,4)14-13-24(27,28)29)31-15-7-10-19-20(25)11-6-12-21(19)26/h5-6,8-9,11-12,22H,7,10,13-16H2,1-4H3/q+1 |
| InChIKey | LGGRFILAULSPJH-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|