C19H20N2O5 — CID 23503015
N,6-dihydroxy-6-[4-(4-hydroxy-1,3-benzoxazol-2-yl)phenyl]hexanamide (PubChem CID 23503015) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is N,6-dihydroxy-6-[4-(4-hydroxy-1,3-benzoxazol-2-yl)phenyl]hexanamide.
| Compound Name | N,6-dihydroxy-6-[4-(4-hydroxy-1,3-benzoxazol-2-yl)phenyl]hexanamide |
|---|---|
| PubChem CID | 23503015 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N,6-dihydroxy-6-[4-(4-hydroxy-1,3-benzoxazol-2-yl)phenyl]hexanamide |
| SMILES | O=C(CCCCC(O)c1ccc(-c2nc3c(O)cccc3o2)cc1)NO |
| InChI | InChI=1S/C19H20N2O5/c22-14(4-1-2-7-17(24)21-25)12-8-10-13(11-9-12)19-20-18-15(23)5-3-6-16(18)26-19/h3,5-6,8-11,14,22-23,25H,1-2,4,7H2,(H,21,24) |
| InChIKey | JZRDVNMMBMTTOY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|