C24H35N5O6S — CID 23503189
4-[(2-butoxy-5-methylsulfonylbenzoyl)amino]-5-ethyl-1-(2-morpholin-4-ylethyl)pyrazole-3-carboxamide (PubChem CID 23503189) has the molecular formula C24H35N5O6S and a molecular weight of 521.64 g/mol. Its IUPAC name is 4-[(2-butoxy-5-methylsulfonylbenzoyl)amino]-5-ethyl-1-(2-morpholin-4-ylethyl)pyrazole-3-carboxamide.
| Compound Name | 4-[(2-butoxy-5-methylsulfonylbenzoyl)amino]-5-ethyl-1-(2-morpholin-4-ylethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 23503189 |
| Molecular Formula | C24H35N5O6S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 4-[(2-butoxy-5-methylsulfonylbenzoyl)amino]-5-ethyl-1-(2-morpholin-4-ylethyl)pyrazole-3-carboxamide |
| SMILES | CCCCOc1ccc(S(C)(=O)=O)cc1C(=O)Nc1c(C(N)=O)nn(CCN2CCOCC2)c1CC |
| InChI | InChI=1S/C24H35N5O6S/c1-4-6-13-35-20-8-7-17(36(3,32)33)16-18(20)24(31)26-21-19(5-2)29(27-22(21)23(25)30)10-9-28-11-14-34-15-12-28/h7-8,16H,4-6,9-15H2,1-3H3,(H2,25,30)(H,26,31) |
| InChIKey | HPRRUPBLOQXXAG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|