About 4-ethenyl-2,6-diethylpyridine
4-ethenyl-2,6-diethylpyridine (PubChem CID 23503903) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 4-ethenyl-2,6-diethylpyridine.
Molecular Properties
| Compound Name | 4-ethenyl-2,6-diethylpyridine |
| PubChem CID | 23503903 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 4-ethenyl-2,6-diethylpyridine |
| SMILES | C=Cc1cc(CC)nc(CC)c1 |
| InChI | InChI=1S/C11H15N/c1-4-9-7-10(5-2)12-11(6-3)8-9/h4,7-8H,1,5-6H2,2-3H3 |
| InChIKey | ZVBVBFGGZJJWHR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenyl-2,6-diethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2,6-diethylpyridine?
The IUPAC name of 4-ethenyl-2,6-diethylpyridine (CID 23503903) is 4-ethenyl-2,6-diethylpyridine.
What is the SMILES notation for 4-ethenyl-2,6-diethylpyridine?
The canonical SMILES for 4-ethenyl-2,6-diethylpyridine is C=Cc1cc(CC)nc(CC)c1.
What is the InChIKey of 4-ethenyl-2,6-diethylpyridine?
The InChIKey is ZVBVBFGGZJJWHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-4-9-7-10(5-2)12-11(6-3)8-9/h4,7-8H,1,5-6H2,2-3H3.
What are the key properties of 4-ethenyl-2,6-diethylpyridine?
4-ethenyl-2,6-diethylpyridine has a molecular weight of 161.25 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2,6-diethylpyridine is sourced from PubChem (CID 23503903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).