About (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate
(2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate (PubChem CID 23504297) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate.
Molecular Properties
| Compound Name | (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate |
| PubChem CID | 23504297 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OC1COC(=O)O1 |
| InChI | InChI=1S/C8H10O5/c1-3-5(2)7(9)12-6-4-11-8(10)13-6/h6H,2-4H2,1H3 |
| InChIKey | QNCWPRHWUXFQBR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate?
The IUPAC name of (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate (CID 23504297) is (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate.
What is the SMILES notation for (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate?
The canonical SMILES for (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate is C=C(CC)C(=O)OC1COC(=O)O1.
What is the InChIKey of (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate?
The InChIKey is QNCWPRHWUXFQBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5/c1-3-5(2)7(9)12-6-4-11-8(10)13-6/h6H,2-4H2,1H3.
What are the key properties of (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate?
(2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate has a molecular weight of 186.16 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,3-dioxolan-4-yl) 2-methylidenebutanoate is sourced from PubChem (CID 23504297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).