About 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol
2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol (PubChem CID 23504308) has the molecular formula C10H10N6O8
and a molecular weight of 342.22 g/mol. Its IUPAC name is 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol.
Molecular Properties
| Compound Name | 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol |
| PubChem CID | 23504308 |
| Molecular Formula | C10H10N6O8 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol |
| SMILES | CN1CC(=O)N=C1N.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7.C4H7N3O/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;1-7-2-3(8)6-4(7)5/h1-2,10H;2H2,1H3,(H2,5,6,8) |
| InChIKey | YLCJRUYQUMQOCI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 208.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol?
The IUPAC name of 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol (CID 23504308) is 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol.
What is the SMILES notation for 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol?
The canonical SMILES for 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol is CN1CC(=O)N=C1N.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.
What is the InChIKey of 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol?
The InChIKey is YLCJRUYQUMQOCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3O7.C4H7N3O/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;1-7-2-3(8)6-4(7)5/h1-2,10H;2H2,1H3,(H2,5,6,8).
What are the key properties of 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol?
2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol has a molecular weight of 342.22 g/mol, XLogP of -0.11, 3 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-methyl-4H-imidazol-5-one;2,4,6-trinitrophenol is sourced from PubChem (CID 23504308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).