About 1,4,5,5a-tetrahydrophenazine
1,4,5,5a-tetrahydrophenazine (PubChem CID 23504326) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 1,4,5,5a-tetrahydrophenazine.
Molecular Properties
| Compound Name | 1,4,5,5a-tetrahydrophenazine |
| PubChem CID | 23504326 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1,4,5,5a-tetrahydrophenazine |
| SMILES | C1=CC2=NC3=C(CC=CC3)NC2C=C1 |
| InChI | InChI=1S/C12H12N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-6,9,13H,7-8H2 |
| InChIKey | JFOKLNFFLPVQSX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,4,5,5a-tetrahydrophenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,5,5a-tetrahydrophenazine?
The IUPAC name of 1,4,5,5a-tetrahydrophenazine (CID 23504326) is 1,4,5,5a-tetrahydrophenazine.
What is the SMILES notation for 1,4,5,5a-tetrahydrophenazine?
The canonical SMILES for 1,4,5,5a-tetrahydrophenazine is C1=CC2=NC3=C(CC=CC3)NC2C=C1.
What is the InChIKey of 1,4,5,5a-tetrahydrophenazine?
The InChIKey is JFOKLNFFLPVQSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-6,9,13H,7-8H2.
What are the key properties of 1,4,5,5a-tetrahydrophenazine?
1,4,5,5a-tetrahydrophenazine has a molecular weight of 184.24 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,5,5a-tetrahydrophenazine is sourced from PubChem (CID 23504326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).