About 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate
1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate (PubChem CID 23504393) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate |
| PubChem CID | 23504393 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)N1CCCC1 |
| InChI | InChI=1S/C10H17NO2/c1-8(2)10(12)13-9(3)11-6-4-5-7-11/h9H,1,4-7H2,2-3H3 |
| InChIKey | QLGHKEDKOQUQBP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate?
The IUPAC name of 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate (CID 23504393) is 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate.
What is the SMILES notation for 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate?
The canonical SMILES for 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate is C=C(C)C(=O)OC(C)N1CCCC1.
What is the InChIKey of 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate?
The InChIKey is QLGHKEDKOQUQBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-8(2)10(12)13-9(3)11-6-4-5-7-11/h9H,1,4-7H2,2-3H3.
What are the key properties of 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate?
1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate has a molecular weight of 183.25 g/mol, XLogP of 1.55, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrolidin-1-ylethyl 2-methylprop-2-enoate is sourced from PubChem (CID 23504393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).