About 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate
2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate (PubChem CID 23504967) has the molecular formula C9H14O7
and a molecular weight of 234.20 g/mol. Its IUPAC name is 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate.
Molecular Properties
| Compound Name | 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate |
| PubChem CID | 23504967 |
| Molecular Formula | C9H14O7 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate |
| SMILES | CC(O)C(=O)OC(=O)C(C)(O)C(=O)C(C)O |
| InChI | InChI=1S/C9H14O7/c1-4(10)6(12)9(3,15)8(14)16-7(13)5(2)11/h4-5,10-11,15H,1-3H3 |
| InChIKey | ACOTYEBWWURHFR-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate?
The IUPAC name of 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate (CID 23504967) is 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate.
What is the SMILES notation for 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate?
The canonical SMILES for 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate is CC(O)C(=O)OC(=O)C(C)(O)C(=O)C(C)O.
What is the InChIKey of 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate?
The InChIKey is ACOTYEBWWURHFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O7/c1-4(10)6(12)9(3,15)8(14)16-7(13)5(2)11/h4-5,10-11,15H,1-3H3.
What are the key properties of 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate?
2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate has a molecular weight of 234.20 g/mol, XLogP of -1.86, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoyl 2,4-dihydroxy-2-methyl-3-oxopentanoate is sourced from PubChem (CID 23504967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).