About (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone
(4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone (PubChem CID 23505035) has the molecular formula C11H11O2P
and a molecular weight of 206.18 g/mol. Its IUPAC name is (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone.
Molecular Properties
| Compound Name | (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone |
| PubChem CID | 23505035 |
| Molecular Formula | C11H11O2P |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone |
| SMILES | C=Cc1cc(C)c(C(=O)P=O)c(C)c1 |
| InChI | InChI=1S/C11H11O2P/c1-4-9-5-7(2)10(8(3)6-9)11(12)14-13/h4-6H,1H2,2-3H3 |
| InChIKey | AXSIWRLXXPIMIF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone?
The IUPAC name of (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone (CID 23505035) is (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone.
What is the SMILES notation for (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone?
The canonical SMILES for (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone is C=Cc1cc(C)c(C(=O)P=O)c(C)c1.
What is the InChIKey of (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone?
The InChIKey is AXSIWRLXXPIMIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11O2P/c1-4-9-5-7(2)10(8(3)6-9)11(12)14-13/h4-6H,1H2,2-3H3.
What are the key properties of (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone?
(4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone has a molecular weight of 206.18 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenyl-2,6-dimethylphenyl)-phosphorosomethanone is sourced from PubChem (CID 23505035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).