About 6-aminocyclohexa-2,4-dien-1-ol
6-aminocyclohexa-2,4-dien-1-ol (PubChem CID 23505214) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is 6-aminocyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-aminocyclohexa-2,4-dien-1-ol |
| PubChem CID | 23505214 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 6-aminocyclohexa-2,4-dien-1-ol |
| SMILES | NC1C=CC=CC1O |
| InChI | InChI=1S/C6H9NO/c7-5-3-1-2-4-6(5)8/h1-6,8H,7H2 |
| InChIKey | KPBPELYSMUXHJS-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-aminocyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminocyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-aminocyclohexa-2,4-dien-1-ol (CID 23505214) is 6-aminocyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-aminocyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-aminocyclohexa-2,4-dien-1-ol is NC1C=CC=CC1O.
What is the InChIKey of 6-aminocyclohexa-2,4-dien-1-ol?
The InChIKey is KPBPELYSMUXHJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO/c7-5-3-1-2-4-6(5)8/h1-6,8H,7H2.
What are the key properties of 6-aminocyclohexa-2,4-dien-1-ol?
6-aminocyclohexa-2,4-dien-1-ol has a molecular weight of 111.14 g/mol, XLogP of -0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminocyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 23505214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).