C22H23ClN2O4S — CID 23505494
2-[[4-(4-chlorophenyl)phenyl]sulfanylmethyl]-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid (PubChem CID 23505494) has the molecular formula C22H23ClN2O4S and a molecular weight of 446.96 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)phenyl]sulfanylmethyl]-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid.
| Compound Name | 2-[[4-(4-chlorophenyl)phenyl]sulfanylmethyl]-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 23505494 |
| Molecular Formula | C22H23ClN2O4S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)phenyl]sulfanylmethyl]-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid |
| SMILES | CN1C(=O)N(CC(CSc2ccc(-c3ccc(Cl)cc3)cc2)C(=O)O)C(=O)C1(C)C |
| InChI | InChI=1S/C22H23ClN2O4S/c1-22(2)20(28)25(21(29)24(22)3)12-16(19(26)27)13-30-18-10-6-15(7-11-18)14-4-8-17(23)9-5-14/h4-11,16H,12-13H2,1-3H3,(H,26,27) |
| InChIKey | SZRQOENVDSUIAX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|