About 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one
8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one (PubChem CID 23505631) has the molecular formula C19H15N3O4
and a molecular weight of 349.35 g/mol. Its IUPAC name is 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one.
Molecular Properties
| Compound Name | 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one |
| PubChem CID | 23505631 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one |
| SMILES | CC(C)n1c(=O)nc(-c2ccc3ocnc3c2)c2cc3c(cc21)COO3 |
| InChI | InChI=1S/C19H15N3O4/c1-10(2)22-15-6-12-8-25-26-17(12)7-13(15)18(21-19(22)23)11-3-4-16-14(5-11)20-9-24-16/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | WJNFVDBJEQFBEE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 79.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one?
The IUPAC name of 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one (CID 23505631) is 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one.
What is the SMILES notation for 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one?
The canonical SMILES for 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one is CC(C)n1c(=O)nc(-c2ccc3ocnc3c2)c2cc3c(cc21)COO3.
What is the InChIKey of 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one?
The InChIKey is WJNFVDBJEQFBEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O4/c1-10(2)22-15-6-12-8-25-26-17(12)7-13(15)18(21-19(22)23)11-3-4-16-14(5-11)20-9-24-16/h3-7,9-10H,8H2,1-2H3.
What are the key properties of 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one?
8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one has a molecular weight of 349.35 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,3-benzoxazol-5-yl)-5-propan-2-yl-3H-dioxolo[3,4-g]quinazolin-6-one is sourced from PubChem (CID 23505631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).