C12H15N3O3 — CID 23505699
1-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)-3-propan-2-ylurea (PubChem CID 23505699) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)-3-propan-2-ylurea.
| Compound Name | 1-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 23505699 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1ccc2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C12H15N3O3/c1-7(2)13-11(16)14-8-4-5-10-9(6-8)15(3)12(17)18-10/h4-7H,1-3H3,(H2,13,14,16) |
| InChIKey | UCQINXIFEYVDLA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |