About 3-methylcyclohexene-1,2-dicarboxylic acid
3-methylcyclohexene-1,2-dicarboxylic acid (PubChem CID 23506162) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-methylcyclohexene-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-methylcyclohexene-1,2-dicarboxylic acid |
| PubChem CID | 23506162 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-methylcyclohexene-1,2-dicarboxylic acid |
| SMILES | CC1CCCC(C(=O)O)=C1C(=O)O |
| InChI | InChI=1S/C9H12O4/c1-5-3-2-4-6(8(10)11)7(5)9(12)13/h5H,2-4H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | DWRWRXAXFHRUAC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylcyclohexene-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclohexene-1,2-dicarboxylic acid?
The IUPAC name of 3-methylcyclohexene-1,2-dicarboxylic acid (CID 23506162) is 3-methylcyclohexene-1,2-dicarboxylic acid.
What is the SMILES notation for 3-methylcyclohexene-1,2-dicarboxylic acid?
The canonical SMILES for 3-methylcyclohexene-1,2-dicarboxylic acid is CC1CCCC(C(=O)O)=C1C(=O)O.
What is the InChIKey of 3-methylcyclohexene-1,2-dicarboxylic acid?
The InChIKey is DWRWRXAXFHRUAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-5-3-2-4-6(8(10)11)7(5)9(12)13/h5H,2-4H2,1H3,(H,10,11)(H,12,13).
What are the key properties of 3-methylcyclohexene-1,2-dicarboxylic acid?
3-methylcyclohexene-1,2-dicarboxylic acid has a molecular weight of 184.19 g/mol, XLogP of 1.27, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclohexene-1,2-dicarboxylic acid is sourced from PubChem (CID 23506162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).