C8H9N3O4 — CID 23506187
N-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)acetamide (PubChem CID 23506187) has the molecular formula C8H9N3O4 and a molecular weight of 211.18 g/mol. Its IUPAC name is N-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)acetamide.
| Compound Name | N-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)acetamide |
|---|---|
| PubChem CID | 23506187 |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | N-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)acetamide |
| SMILES | CC(=O)N=C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C8H9N3O4/c1-4(12)9-5-6(13)10(2)8(15)11(3)7(5)14/h1-3H3 |
| InChIKey | CQEHDZPSZNCPLF-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 87.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_sixes(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|