About 1,1-diisocyanatobutane
1,1-diisocyanatobutane (PubChem CID 23506348) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 1,1-diisocyanatobutane.
Molecular Properties
| Compound Name | 1,1-diisocyanatobutane |
| PubChem CID | 23506348 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1,1-diisocyanatobutane |
| SMILES | CCCC(N=C=O)N=C=O |
| InChI | InChI=1S/C6H8N2O2/c1-2-3-6(7-4-9)8-5-10/h6H,2-3H2,1H3 |
| InChIKey | FDYWJVHETVDSRA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diisocyanatobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diisocyanatobutane?
The IUPAC name of 1,1-diisocyanatobutane (CID 23506348) is 1,1-diisocyanatobutane.
What is the SMILES notation for 1,1-diisocyanatobutane?
The canonical SMILES for 1,1-diisocyanatobutane is CCCC(N=C=O)N=C=O.
What is the InChIKey of 1,1-diisocyanatobutane?
The InChIKey is FDYWJVHETVDSRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c1-2-3-6(7-4-9)8-5-10/h6H,2-3H2,1H3.
What are the key properties of 1,1-diisocyanatobutane?
1,1-diisocyanatobutane has a molecular weight of 140.14 g/mol, XLogP of 0.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diisocyanatobutane is sourced from PubChem (CID 23506348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).