About bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone
bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone (PubChem CID 23506461) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone.
Molecular Properties
| Compound Name | bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone |
| PubChem CID | 23506461 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone |
| SMILES | O=C(C1(O)C=CC=CC1)C1(O)C=CC=CC1 |
| InChI | InChI=1S/C13H14O3/c14-11(12(15)7-3-1-4-8-12)13(16)9-5-2-6-10-13/h1-7,9,15-16H,8,10H2 |
| InChIKey | CQAIBOSCGCTHPV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone?
The IUPAC name of bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone (CID 23506461) is bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone.
What is the SMILES notation for bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone?
The canonical SMILES for bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone is O=C(C1(O)C=CC=CC1)C1(O)C=CC=CC1.
What is the InChIKey of bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone?
The InChIKey is CQAIBOSCGCTHPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3/c14-11(12(15)7-3-1-4-8-12)13(16)9-5-2-6-10-13/h1-7,9,15-16H,8,10H2.
What are the key properties of bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone?
bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone has a molecular weight of 218.25 g/mol, XLogP of 1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-hydroxycyclohexa-2,4-dien-1-yl)methanone is sourced from PubChem (CID 23506461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).